C8H7O2- — CID 5247370
octa-2,4-diynoate (PubChem CID 5247370) has the molecular formula C8H7O2- and a molecular weight of 135.14 g/mol. Its IUPAC name is octa-2,4-diynoate.
| Compound Name | octa-2,4-diynoate |
|---|---|
| PubChem CID | 5247370 |
| Molecular Formula | C8H7O2- |
| Molecular Weight | 135.14 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | octa-2,4-diynoate |
| SMILES | CCCC#CC#CC(=O)[O-] |
| InChI | InChI=1S/C8H8O2/c1-2-3-4-5-6-7-8(9)10/h2-3H2,1H3,(H,9,10)/p-1 |
| InChIKey | XHSPALGTVLZQLW-UHFFFAOYSA-M |
| XLogP | -0.46 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.14 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|