About hex-2-ynethioic S-acid
hex-2-ynethioic S-acid (PubChem CID 57208590) has the molecular formula C6H8OS
and a molecular weight of 128.20 g/mol. Its IUPAC name is hex-2-ynethioic S-acid.
Molecular Properties
| Compound Name | hex-2-ynethioic S-acid |
| PubChem CID | 57208590 |
| Molecular Formula | C6H8OS |
| Molecular Weight | 128.20 g/mol |
| Exact Mass | 128.03 |
| IUPAC Name | hex-2-ynethioic S-acid |
| SMILES | CCCC#CC(=O)S |
| InChI | InChI=1S/C6H8OS/c1-2-3-4-5-6(7)8/h2-3H2,1H3,(H,7,8) |
| InChIKey | AXWLXGKLVWIWBA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hex-2-ynethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-2-ynethioic S-acid?
The IUPAC name of hex-2-ynethioic S-acid (CID 57208590) is hex-2-ynethioic S-acid.
What is the SMILES notation for hex-2-ynethioic S-acid?
The canonical SMILES for hex-2-ynethioic S-acid is CCCC#CC(=O)S.
What is the InChIKey of hex-2-ynethioic S-acid?
The InChIKey is AXWLXGKLVWIWBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8OS/c1-2-3-4-5-6(7)8/h2-3H2,1H3,(H,7,8).
What are the key properties of hex-2-ynethioic S-acid?
hex-2-ynethioic S-acid has a molecular weight of 128.20 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hex-2-ynethioic S-acid is sourced from PubChem (CID 57208590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).