About hept-3-ynamide
hept-3-ynamide (PubChem CID 55289382) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is hept-3-ynamide.
Molecular Properties
| Compound Name | hept-3-ynamide |
| PubChem CID | 55289382 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | hept-3-ynamide |
| SMILES | CCCC#CCC(N)=O |
| InChI | InChI=1S/C7H11NO/c1-2-3-4-5-6-7(8)9/h2-3,6H2,1H3,(H2,8,9) |
| InChIKey | IDUVUFQIDLGGLC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hept-3-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-3-ynamide?
The IUPAC name of hept-3-ynamide (CID 55289382) is hept-3-ynamide.
What is the SMILES notation for hept-3-ynamide?
The canonical SMILES for hept-3-ynamide is CCCC#CCC(N)=O.
What is the InChIKey of hept-3-ynamide?
The InChIKey is IDUVUFQIDLGGLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO/c1-2-3-4-5-6-7(8)9/h2-3,6H2,1H3,(H2,8,9).
What are the key properties of hept-3-ynamide?
hept-3-ynamide has a molecular weight of 125.17 g/mol, XLogP of 0.67, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hept-3-ynamide is sourced from PubChem (CID 55289382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).