C18H31NO2 — CID 87990154
ethanol;hexadeca-5,7-diynamide (PubChem CID 87990154) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is ethanol;hexadeca-5,7-diynamide.
| Compound Name | ethanol;hexadeca-5,7-diynamide |
|---|---|
| PubChem CID | 87990154 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | ethanol;hexadeca-5,7-diynamide |
| SMILES | CCCCCCCCC#CC#CCCCC(N)=O.CCO |
| InChI | InChI=1S/C16H25NO.C2H6O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-2-3/h2-8,13-15H2,1H3,(H2,17,18);3H,2H2,1H3 |
| InChIKey | RNOSLGVLZZZLPR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|