About dodeca-5,7-diynedioate
dodeca-5,7-diynedioate (PubChem CID 7019580) has the molecular formula C12H12O4-2
and a molecular weight of 220.22 g/mol. Its IUPAC name is dodeca-5,7-diynedioate.
Molecular Properties
| Compound Name | dodeca-5,7-diynedioate |
| PubChem CID | 7019580 |
| Molecular Formula | C12H12O4-2 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | dodeca-5,7-diynedioate |
| SMILES | O=C([O-])CCCC#CC#CCCCC(=O)[O-] |
| InChI | InChI=1S/C12H14O4/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h5-10H2,(H,13,14)(H,15,16)/p-2 |
| InChIKey | SVCWXPPYJQWHRS-UHFFFAOYSA-L |
| XLogP | -1.17 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dodeca-5,7-diynedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodeca-5,7-diynedioate?
The IUPAC name of dodeca-5,7-diynedioate (CID 7019580) is dodeca-5,7-diynedioate.
What is the SMILES notation for dodeca-5,7-diynedioate?
The canonical SMILES for dodeca-5,7-diynedioate is O=C([O-])CCCC#CC#CCCCC(=O)[O-].
What is the InChIKey of dodeca-5,7-diynedioate?
The InChIKey is SVCWXPPYJQWHRS-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H14O4/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h5-10H2,(H,13,14)(H,15,16)/p-2.
What are the key properties of dodeca-5,7-diynedioate?
dodeca-5,7-diynedioate has a molecular weight of 220.22 g/mol, XLogP of -1.17, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dodeca-5,7-diynedioate is sourced from PubChem (CID 7019580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).