C15H25N2O+ — CID 118885282
2-(deca-4,6-diynoylamino)ethyl-trimethylazanium (PubChem CID 118885282) has the molecular formula C15H25N2O+ and a molecular weight of 249.38 g/mol. Its IUPAC name is 2-(deca-4,6-diynoylamino)ethyl-trimethylazanium.
| Compound Name | 2-(deca-4,6-diynoylamino)ethyl-trimethylazanium |
|---|---|
| PubChem CID | 118885282 |
| Molecular Formula | C15H25N2O+ |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 2-(deca-4,6-diynoylamino)ethyl-trimethylazanium |
| SMILES | CCCC#CC#CCCC(=O)NCC[N+](C)(C)C |
| InChI | InChI=1S/C15H24N2O/c1-5-6-7-8-9-10-11-12-15(18)16-13-14-17(2,3)4/h5-6,11-14H2,1-4H3/p+1 |
| InChIKey | KMWIGINXTVWXQZ-UHFFFAOYSA-O |
| XLogP | 1.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|