C33H51N3NaO2+ — CID 58059964
sodium 2-[[22-(anilino)-22-oxodocosa-10,12-diynoyl]amino]ethyl-trimethylazanium (PubChem CID 58059964) has the molecular formula C33H51N3NaO2+ and a molecular weight of 544.78 g/mol. Its IUPAC name is sodium 2-[[22-(anilino)-22-oxodocosa-10,12-diynoyl]amino]ethyl-trimethylazanium.
| Compound Name | sodium 2-[[22-(anilino)-22-oxodocosa-10,12-diynoyl]amino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 58059964 |
| Molecular Formula | C33H51N3NaO2+ |
| Molecular Weight | 544.78 g/mol |
| Exact Mass | 544.39 |
| IUPAC Name | sodium 2-[[22-(anilino)-22-oxodocosa-10,12-diynoyl]amino]ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCNC(=O)CCCCCCCCC#CC#CCCCCCCCCC(=O)Nc1cc[c-]cc1.[Na+] |
| InChI | InChI=1S/C33H51N3O2.Na/c1-36(2,3)30-29-34-32(37)27-23-18-16-14-12-10-8-6-4-5-7-9-11-13-15-17-19-24-28-33(38)35-31-25-21-20-22-26-31;/h21-22,25-26H,8-19,23-24,27-30H2,1-3H3,(H,34,37)(H,35,38);/q;+1 |
| InChIKey | MHTMLBIJGBSRFM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.78 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|