About hexadeca-2,4-diynoate
hexadeca-2,4-diynoate (PubChem CID 102596611) has the molecular formula C16H23O2-
and a molecular weight of 247.36 g/mol. Its IUPAC name is hexadeca-2,4-diynoate.
Molecular Properties
| Compound Name | hexadeca-2,4-diynoate |
| PubChem CID | 102596611 |
| Molecular Formula | C16H23O2- |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | hexadeca-2,4-diynoate |
| SMILES | CCCCCCCCCCCC#CC#CC(=O)[O-] |
| InChI | InChI=1S/C16H24O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-11H2,1H3,(H,17,18)/p-1 |
| InChIKey | LZOZBPHHFMJFGU-UHFFFAOYSA-M |
| XLogP | 2.66 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hexadeca-2,4-diynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadeca-2,4-diynoate?
The IUPAC name of hexadeca-2,4-diynoate (CID 102596611) is hexadeca-2,4-diynoate.
What is the SMILES notation for hexadeca-2,4-diynoate?
The canonical SMILES for hexadeca-2,4-diynoate is CCCCCCCCCCCC#CC#CC(=O)[O-].
What is the InChIKey of hexadeca-2,4-diynoate?
The InChIKey is LZOZBPHHFMJFGU-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H24O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-11H2,1H3,(H,17,18)/p-1.
What are the key properties of hexadeca-2,4-diynoate?
hexadeca-2,4-diynoate has a molecular weight of 247.36 g/mol, XLogP of 2.66, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadeca-2,4-diynoate is sourced from PubChem (CID 102596611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).