About dodeca-5,7-diyn-4-one
dodeca-5,7-diyn-4-one (PubChem CID 125494229) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is dodeca-5,7-diyn-4-one.
Molecular Properties
| Compound Name | dodeca-5,7-diyn-4-one |
| PubChem CID | 125494229 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | dodeca-5,7-diyn-4-one |
| SMILES | CCCCC#CC#CC(=O)CCC |
| InChI | InChI=1S/C12H16O/c1-3-5-6-7-8-9-11-12(13)10-4-2/h3-6,10H2,1-2H3 |
| InChIKey | RAZIWQQQCQSWDB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dodeca-5,7-diyn-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodeca-5,7-diyn-4-one?
The IUPAC name of dodeca-5,7-diyn-4-one (CID 125494229) is dodeca-5,7-diyn-4-one.
What is the SMILES notation for dodeca-5,7-diyn-4-one?
The canonical SMILES for dodeca-5,7-diyn-4-one is CCCCC#CC#CC(=O)CCC.
What is the InChIKey of dodeca-5,7-diyn-4-one?
The InChIKey is RAZIWQQQCQSWDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-3-5-6-7-8-9-11-12(13)10-4-2/h3-6,10H2,1-2H3.
What are the key properties of dodeca-5,7-diyn-4-one?
dodeca-5,7-diyn-4-one has a molecular weight of 176.26 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dodeca-5,7-diyn-4-one is sourced from PubChem (CID 125494229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).