C8H13NO — CID 124512652
trans-(1R,3S)-3-amino-1-ethynylcyclohexan-1-ol (PubChem CID 124512652) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is trans-(1R,3S)-3-amino-1-ethynylcyclohexan-1-ol.
| Compound Name | trans-(1R,3S)-3-amino-1-ethynylcyclohexan-1-ol |
|---|---|
| PubChem CID | 124512652 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | trans-(1R,3S)-3-amino-1-ethynylcyclohexan-1-ol |
| SMILES | C#C[C@@]1(O)CCC[C@H](N)C1 |
| InChI | InChI=1S/C8H13NO/c1-2-8(10)5-3-4-7(9)6-8/h1,7,10H,3-6,9H2/t7-,8+/m0/s1 |
| InChIKey | JTNKCPPDRFMMPB-JGVFFNPUSA-N |
| XLogP | 0.25 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|