C10H14O — CID 175858950
2-ethynyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ol (PubChem CID 175858950) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-ethynyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ol.
| Compound Name | 2-ethynyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ol |
|---|---|
| PubChem CID | 175858950 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2-ethynyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ol |
| SMILES | C#CC1(O)CC2CCCC2C1 |
| InChI | InChI=1S/C10H14O/c1-2-10(11)6-8-4-3-5-9(8)7-10/h1,8-9,11H,3-7H2 |
| InChIKey | ZBLWGVAVACWUPW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|