C8H17NO — CID 97052724
cis-(1S,3S)-3-amino-1-ethylcyclohexan-1-ol (PubChem CID 97052724) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is cis-(1S,3S)-3-amino-1-ethylcyclohexan-1-ol.
| Compound Name | cis-(1S,3S)-3-amino-1-ethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 97052724 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | cis-(1S,3S)-3-amino-1-ethylcyclohexan-1-ol |
| SMILES | CC[C@]1(O)CCC[C@H](N)C1 |
| InChI | InChI=1S/C8H17NO/c1-2-8(10)5-3-4-7(9)6-8/h7,10H,2-6,9H2,1H3/t7-,8-/m0/s1 |
| InChIKey | ITBPCBNLAJZQGY-YUMQZZPRSA-N |
| XLogP | 1.03 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |