C16H18O — CID 102147005
1-ethynyl-2-(1-phenylethenyl)cyclohexan-1-ol (PubChem CID 102147005) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-ethynyl-2-(1-phenylethenyl)cyclohexan-1-ol.
| Compound Name | 1-ethynyl-2-(1-phenylethenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102147005 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 1-ethynyl-2-(1-phenylethenyl)cyclohexan-1-ol |
| SMILES | C#CC1(O)CCCCC1C(=C)c1ccccc1 |
| InChI | InChI=1S/C16H18O/c1-3-16(17)12-8-7-11-15(16)13(2)14-9-5-4-6-10-14/h1,4-6,9-10,15,17H,2,7-8,11-12H2 |
| InChIKey | HKWXITWFGPUKTB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|