C15H20O2 — CID 101024510
trans-(1R,2S)-1-(2-phenylprop-2-enyl)cyclohexane-1,2-diol (PubChem CID 101024510) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is trans-(1R,2S)-1-(2-phenylprop-2-enyl)cyclohexane-1,2-diol.
| Compound Name | trans-(1R,2S)-1-(2-phenylprop-2-enyl)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 101024510 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | trans-(1R,2S)-1-(2-phenylprop-2-enyl)cyclohexane-1,2-diol |
| SMILES | C=C(C[C@]1(O)CCCC[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C15H20O2/c1-12(13-7-3-2-4-8-13)11-15(17)10-6-5-9-14(15)16/h2-4,7-8,14,16-17H,1,5-6,9-11H2/t14-,15+/m0/s1 |
| InChIKey | QTAVYSCEMRCPGT-LSDHHAIUSA-N |
| XLogP | 2.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |