About trans-(1R,2S)-1-(2-hydroxyethyl)cyclohexane-1,2-diol
trans-(1R,2S)-1-(2-hydroxyethyl)cyclohexane-1,2-diol (PubChem CID 130991462) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is trans-(1R,2S)-1-(2-hydroxyethyl)cyclohexane-1,2-diol.
Analyze trans-(1R,2S)-1-(2-hydroxyethyl)cyclohexane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2S)-1-(2-hydroxyethyl)cyclohexane-1,2-diol?
The IUPAC name of trans-(1R,2S)-1-(2-hydroxyethyl)cyclohexane-1,2-diol (CID 130991462) is trans-(1R,2S)-1-(2-hydroxyethyl)cyclohexane-1,2-diol.
What is the SMILES notation for trans-(1R,2S)-1-(2-hydroxyethyl)cyclohexane-1,2-diol?
The canonical SMILES for trans-(1R,2S)-1-(2-hydroxyethyl)cyclohexane-1,2-diol is OCC[C@]1(O)CCCC[C@@H]1O.
What is the InChIKey of trans-(1R,2S)-1-(2-hydroxyethyl)cyclohexane-1,2-diol?
The InChIKey is WGRIEJJMAKLIFO-JGVFFNPUSA-N. The full InChI is InChI=1S/C8H16O3/c9-6-5-8(11)4-2-1-3-7(8)10/h7,9-11H,1-6H2/t7-,8+/m0/s1.
What are the key properties of trans-(1R,2S)-1-(2-hydroxyethyl)cyclohexane-1,2-diol?
trans-(1R,2S)-1-(2-hydroxyethyl)cyclohexane-1,2-diol has a molecular weight of 160.21 g/mol, XLogP of 0.03, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2S)-1-(2-hydroxyethyl)cyclohexane-1,2-diol is sourced from PubChem (CID 130991462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).