C7H11NO2 — CID 130142856
2-(1,2-dihydroxycyclopentyl)acetonitrile (PubChem CID 130142856) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 2-(1,2-dihydroxycyclopentyl)acetonitrile.
| Compound Name | 2-(1,2-dihydroxycyclopentyl)acetonitrile |
|---|---|
| PubChem CID | 130142856 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 2-(1,2-dihydroxycyclopentyl)acetonitrile |
| SMILES | N#CCC1(O)CCCC1O |
| InChI | InChI=1S/C7H11NO2/c8-5-4-7(10)3-1-2-6(7)9/h6,9-10H,1-4H2 |
| InChIKey | OKUDHLUFYGHMRF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |