C19H16S — CID 102473499
(3S,4R)-4-ethynyl-3-(1-phenylethenyl)-3,4-dihydro-2H-thiochromene (PubChem CID 102473499) has the molecular formula C19H16S and a molecular weight of 276.40 g/mol. Its IUPAC name is (3S,4R)-4-ethynyl-3-(1-phenylethenyl)-3,4-dihydro-2H-thiochromene.
| Compound Name | (3S,4R)-4-ethynyl-3-(1-phenylethenyl)-3,4-dihydro-2H-thiochromene |
|---|---|
| PubChem CID | 102473499 |
| Molecular Formula | C19H16S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (3S,4R)-4-ethynyl-3-(1-phenylethenyl)-3,4-dihydro-2H-thiochromene |
| SMILES | C#C[C@@H]1c2ccccc2SC[C@@H]1C(=C)c1ccccc1 |
| InChI | InChI=1S/C19H16S/c1-3-16-17-11-7-8-12-19(17)20-13-18(16)14(2)15-9-5-4-6-10-15/h1,4-12,16,18H,2,13H2/t16-,18-/m1/s1 |
| InChIKey | QGZOHUIISMVZNH-SJLPKXTDSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|