C12H13NS — CID 105077457
1-(2,3-dihydro-1-benzothiophen-3-yl)but-3-yn-1-amine (PubChem CID 105077457) has the molecular formula C12H13NS and a molecular weight of 203.31 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-3-yl)but-3-yn-1-amine.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-3-yl)but-3-yn-1-amine |
|---|---|
| PubChem CID | 105077457 |
| Molecular Formula | C12H13NS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-3-yl)but-3-yn-1-amine |
| SMILES | C#CCC(N)C1CSc2ccccc21 |
| InChI | InChI=1S/C12H13NS/c1-2-5-11(13)10-8-14-12-7-4-3-6-9(10)12/h1,3-4,6-7,10-11H,5,8,13H2 |
| InChIKey | WXNYSTWTFPNNDN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|