C18H13NOS — CID 105121584
2,3-dihydro-1-benzothiophen-3-yl(quinolin-6-yl)methanone (PubChem CID 105121584) has the molecular formula C18H13NOS and a molecular weight of 291.38 g/mol. Its IUPAC name is 2,3-dihydro-1-benzothiophen-3-yl(quinolin-6-yl)methanone.
| Compound Name | 2,3-dihydro-1-benzothiophen-3-yl(quinolin-6-yl)methanone |
|---|---|
| PubChem CID | 105121584 |
| Molecular Formula | C18H13NOS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2,3-dihydro-1-benzothiophen-3-yl(quinolin-6-yl)methanone |
| SMILES | O=C(c1ccc2ncccc2c1)C1CSc2ccccc21 |
| InChI | InChI=1S/C18H13NOS/c20-18(15-11-21-17-6-2-1-5-14(15)17)13-7-8-16-12(10-13)4-3-9-19-16/h1-10,15H,11H2 |
| InChIKey | UWFAODKEUXTCRD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |