About 2,3-dihydro-1-benzothiophen-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone
2,3-dihydro-1-benzothiophen-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone (PubChem CID 106784824) has the molecular formula C13H8F3NOS2
and a molecular weight of 315.34 g/mol. Its IUPAC name is 2,3-dihydro-1-benzothiophen-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone.
Molecular Properties
| Compound Name | 2,3-dihydro-1-benzothiophen-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
| PubChem CID | 106784824 |
| Molecular Formula | C13H8F3NOS2 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 2,3-dihydro-1-benzothiophen-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1cnc(C(F)(F)F)s1)C1CSc2ccccc21 |
| InChI | InChI=1S/C13H8F3NOS2/c14-13(15,16)12-17-5-10(20-12)11(18)8-6-19-9-4-2-1-3-7(8)9/h1-5,8H,6H2 |
| InChIKey | QSFLBRHISXKWOQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydro-1-benzothiophen-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1-benzothiophen-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone?
The IUPAC name of 2,3-dihydro-1-benzothiophen-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone (CID 106784824) is 2,3-dihydro-1-benzothiophen-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone.
What is the SMILES notation for 2,3-dihydro-1-benzothiophen-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone?
The canonical SMILES for 2,3-dihydro-1-benzothiophen-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone is O=C(c1cnc(C(F)(F)F)s1)C1CSc2ccccc21.
What is the InChIKey of 2,3-dihydro-1-benzothiophen-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone?
The InChIKey is QSFLBRHISXKWOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F3NOS2/c14-13(15,16)12-17-5-10(20-12)11(18)8-6-19-9-4-2-1-3-7(8)9/h1-5,8H,6H2.
What are the key properties of 2,3-dihydro-1-benzothiophen-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone?
2,3-dihydro-1-benzothiophen-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone has a molecular weight of 315.34 g/mol, XLogP of 4.23, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1-benzothiophen-3-yl-[2-(trifluoromethyl)-1,3-thiazol-5-yl]methanone is sourced from PubChem (CID 106784824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).