C6H14NO+ — CID 171460673
[(1R,2R)-2-hydroxy-2-methylcyclopentyl]azanium (PubChem CID 171460673) has the molecular formula C6H14NO+ and a molecular weight of 116.18 g/mol. Its IUPAC name is [(1R,2R)-2-hydroxy-2-methylcyclopentyl]azanium.
| Compound Name | [(1R,2R)-2-hydroxy-2-methylcyclopentyl]azanium |
|---|---|
| PubChem CID | 171460673 |
| Molecular Formula | C6H14NO+ |
| Molecular Weight | 116.18 g/mol |
| Exact Mass | 116.11 |
| IUPAC Name | [(1R,2R)-2-hydroxy-2-methylcyclopentyl]azanium |
| SMILES | C[C@@]1(O)CCC[C@H]1[NH3+] |
| InChI | InChI=1S/C6H13NO/c1-6(8)4-2-3-5(6)7/h5,8H,2-4,7H2,1H3/p+1/t5-,6-/m1/s1 |
| InChIKey | KKBCPZUWBKCECT-PHDIDXHHSA-O |
| XLogP | -0.47 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.18 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |