C13H22O3 — CID 101254787
[(1S,4R,4aR,8aR)-4-hydroxy-4-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl] acetate (PubChem CID 101254787) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is [(1S,4R,4aR,8aR)-4-hydroxy-4-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl] acetate.
| Compound Name | [(1S,4R,4aR,8aR)-4-hydroxy-4-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 101254787 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | [(1S,4R,4aR,8aR)-4-hydroxy-4-methyl-2,3,4a,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@](C)(O)[C@@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C13H22O3/c1-9(14)16-12-7-8-13(2,15)11-6-4-3-5-10(11)12/h10-12,15H,3-8H2,1-2H3/t10-,11-,12+,13-/m1/s1 |
| InChIKey | YZWMZZFELMIAON-FVCCEPFGSA-N |
| XLogP | 2.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |