C21H36O2 — CID 50990049
(5R,8S,10S,11S,13S,14S,17S)-10,11,13,17-tetramethyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-11,17-diol (PubChem CID 50990049) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is (5R,8S,10S,11S,13S,14S,17S)-10,11,13,17-tetramethyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-11,17-diol.
| Compound Name | (5R,8S,10S,11S,13S,14S,17S)-10,11,13,17-tetramethyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-11,17-diol |
|---|---|
| PubChem CID | 50990049 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | (5R,8S,10S,11S,13S,14S,17S)-10,11,13,17-tetramethyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-11,17-diol |
| SMILES | CC1(O)C[C@@]2(C)[C@@H](CC[C@]2(C)O)[C@@H]2CC[C@H]3CCCC[C@]3(C)C21 |
| InChI | InChI=1S/C21H36O2/c1-18-11-6-5-7-14(18)8-9-15-16-10-12-21(4,23)19(16,2)13-20(3,22)17(15)18/h14-17,22-23H,5-13H2,1-4H3/t14-,15+,16+,17?,18+,19+,20?,21+/m1/s1 |
| InChIKey | AUJYFVLNTWWEIM-YDTMHBHSSA-N |
| XLogP | 4.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |