C16H28O — CID 10609881
[(1S,4aS,7R,8aS)-1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl]methanol (PubChem CID 10609881) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is [(1S,4aS,7R,8aS)-1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl]methanol.
| Compound Name | [(1S,4aS,7R,8aS)-1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 10609881 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | [(1S,4aS,7R,8aS)-1,4a-dimethyl-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl]methanol |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C)CCC[C@](C)(CO)[C@H]2C1 |
| InChI | InChI=1S/C16H28O/c1-12(2)13-6-9-15(3)7-5-8-16(4,11-17)14(15)10-13/h13-14,17H,1,5-11H2,2-4H3/t13-,14+,15+,16-/m1/s1 |
| InChIKey | CYQIWPJEICJZSG-FXUDXRNXSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|