C15H23O3- — CID 11862142
2-[(2R,4aS,8S,8aR)-8-hydroxy-4a,8-dimethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]prop-2-enoate (PubChem CID 11862142) has the molecular formula C15H23O3- and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-[(2R,4aS,8S,8aR)-8-hydroxy-4a,8-dimethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]prop-2-enoate.
| Compound Name | 2-[(2R,4aS,8S,8aR)-8-hydroxy-4a,8-dimethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11862142 |
| Molecular Formula | C15H23O3- |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-[(2R,4aS,8S,8aR)-8-hydroxy-4a,8-dimethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)[O-])[C@@H]1CC[C@]2(C)CCC[C@](C)(O)[C@@H]2C1 |
| InChI | InChI=1S/C15H24O3/c1-10(13(16)17)11-5-8-14(2)6-4-7-15(3,18)12(14)9-11/h11-12,18H,1,4-9H2,2-3H3,(H,16,17)/p-1/t11-,12-,14+,15+/m1/s1 |
| InChIKey | FXKCXGBBUBCRPU-UXOAXIEHSA-M |
| XLogP | 1.65 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|