C16H24O3 — CID 122401435
methyl 2-[(1aR,3aS,6R,7aR,7bS)-3a,7b-dimethyl-1a,2,3,4,5,6,7,7a-octahydronaphtho[1,2-b]oxiren-6-yl]prop-2-enoate (PubChem CID 122401435) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is methyl 2-[(1aR,3aS,6R,7aR,7bS)-3a,7b-dimethyl-1a,2,3,4,5,6,7,7a-octahydronaphtho[1,2-b]oxiren-6-yl]prop-2-enoate.
| Compound Name | methyl 2-[(1aR,3aS,6R,7aR,7bS)-3a,7b-dimethyl-1a,2,3,4,5,6,7,7a-octahydronaphtho[1,2-b]oxiren-6-yl]prop-2-enoate |
|---|---|
| PubChem CID | 122401435 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | methyl 2-[(1aR,3aS,6R,7aR,7bS)-3a,7b-dimethyl-1a,2,3,4,5,6,7,7a-octahydronaphtho[1,2-b]oxiren-6-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@@]2(C)CC[C@H]3O[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C16H24O3/c1-10(14(17)18-4)11-5-7-15(2)8-6-13-16(3,19-13)12(15)9-11/h11-13H,1,5-9H2,2-4H3/t11-,12-,13-,15+,16+/m1/s1 |
| InChIKey | CFJNPMNYQILZIE-UVQHHTHUSA-N |
| XLogP | 3.09 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|