C25H30O5 — CID 162894637
methyl 2-[(2R,4aR,8aR)-8-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]-4a-methyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]prop-2-enoate (PubChem CID 162894637) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is methyl 2-[(2R,4aR,8aR)-8-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]-4a-methyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]prop-2-enoate.
| Compound Name | methyl 2-[(2R,4aR,8aR)-8-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]-4a-methyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 162894637 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | methyl 2-[(2R,4aR,8aR)-8-[3-(4-hydroxyphenyl)prop-2-enoyloxymethyl]-4a-methyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@@]2(C)CCC=C(COC(=O)C=Cc3ccc(O)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C25H30O5/c1-17(24(28)29-3)19-12-14-25(2)13-4-5-20(22(25)15-19)16-30-23(27)11-8-18-6-9-21(26)10-7-18/h5-11,19,22,26H,1,4,12-16H2,2-3H3/t19-,22+,25-/m1/s1 |
| InChIKey | MFDYZZOJAFLPGU-RZTXVSJASA-N |
| XLogP | 4.82 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|