C20H30O2 — CID 154708802
ethyl (2E,4E)-5-[(2S,4aS,8aS)-4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]hexa-2,4-dienoate (PubChem CID 154708802) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is ethyl (2E,4E)-5-[(2S,4aS,8aS)-4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]hexa-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-[(2S,4aS,8aS)-4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]hexa-2,4-dienoate |
|---|---|
| PubChem CID | 154708802 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | ethyl (2E,4E)-5-[(2S,4aS,8aS)-4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]hexa-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C(\C)[C@H]1CC[C@]2(C)CCC=C(C)[C@H]2C1 |
| InChI | InChI=1S/C20H30O2/c1-5-22-19(21)10-6-8-15(2)17-11-13-20(4)12-7-9-16(3)18(20)14-17/h6,8-10,17-18H,5,7,11-14H2,1-4H3/b10-6+,15-8+/t17-,18+,20-/m0/s1 |
| InChIKey | RGCYFQSYFXSJMZ-CCDXMLDZSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|