C23H29NO3 — CID 154708798
(4R)-3-(4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalene-2-carbonyl)-4-benzyl-1,3-oxazolidin-2-one (PubChem CID 154708798) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (4R)-3-(4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalene-2-carbonyl)-4-benzyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-(4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalene-2-carbonyl)-4-benzyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 154708798 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (4R)-3-(4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalene-2-carbonyl)-4-benzyl-1,3-oxazolidin-2-one |
| SMILES | CC1=CCCC2(C)CCC(C(=O)N3C(=O)OC[C@H]3Cc3ccccc3)CC12 |
| InChI | InChI=1S/C23H29NO3/c1-16-7-6-11-23(2)12-10-18(14-20(16)23)21(25)24-19(15-27-22(24)26)13-17-8-4-3-5-9-17/h3-5,7-9,18-20H,6,10-15H2,1-2H3/t18?,19-,20?,23?/m1/s1 |
| InChIKey | JQUGRDQNTKNMPD-SVMKLWIASA-N |
| XLogP | 4.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|