C17H20N2O4 — CID 89475510
4-benzyl-3-[(3R)-7-oxoazepane-3-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 89475510) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-benzyl-3-[(3R)-7-oxoazepane-3-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-[(3R)-7-oxoazepane-3-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 89475510 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-benzyl-3-[(3R)-7-oxoazepane-3-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1CCC[C@@H](C(=O)N2C(=O)OCC2Cc2ccccc2)CN1 |
| InChI | InChI=1S/C17H20N2O4/c20-15-8-4-7-13(10-18-15)16(21)19-14(11-23-17(19)22)9-12-5-2-1-3-6-12/h1-3,5-6,13-14H,4,7-11H2,(H,18,20)/t13-,14?/m1/s1 |
| InChIKey | DWXAUHOJGUPRQB-KWCCSABGSA-N |
| XLogP | 1.49 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |