C14H24FO3P — CID 101027986
(1E,4S)-1-(diethoxyphosphorylmethylidene)-2-fluoro-4-prop-1-en-2-ylcyclohexane (PubChem CID 101027986) has the molecular formula C14H24FO3P and a molecular weight of 290.31 g/mol. Its IUPAC name is (1E,4S)-1-(diethoxyphosphorylmethylidene)-2-fluoro-4-prop-1-en-2-ylcyclohexane.
| Compound Name | (1E,4S)-1-(diethoxyphosphorylmethylidene)-2-fluoro-4-prop-1-en-2-ylcyclohexane |
|---|---|
| PubChem CID | 101027986 |
| Molecular Formula | C14H24FO3P |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (1E,4S)-1-(diethoxyphosphorylmethylidene)-2-fluoro-4-prop-1-en-2-ylcyclohexane |
| SMILES | C=C(C)[C@H]1CC/C(=C\P(=O)(OCC)OCC)C(F)C1 |
| InChI | InChI=1S/C14H24FO3P/c1-5-17-19(16,18-6-2)10-13-8-7-12(11(3)4)9-14(13)15/h10,12,14H,3,5-9H2,1-2,4H3/b13-10+/t12-,14?/m0/s1 |
| InChIKey | YFDVEFSWHNSFDR-KIZSSPBKSA-N |
| XLogP | 4.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|