C13H20NO7P — CID 57000842
(1S,2R,5S,6R)-2-amino-4-(diethoxyphosphorylmethylidene)bicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 57000842) has the molecular formula C13H20NO7P and a molecular weight of 333.28 g/mol. Its IUPAC name is (1S,2R,5S,6R)-2-amino-4-(diethoxyphosphorylmethylidene)bicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | (1S,2R,5S,6R)-2-amino-4-(diethoxyphosphorylmethylidene)bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 57000842 |
| Molecular Formula | C13H20NO7P |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (1S,2R,5S,6R)-2-amino-4-(diethoxyphosphorylmethylidene)bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | CCOP(=O)(C=C1C[C@](N)(C(=O)O)[C@@H]2[C@H](C(=O)O)[C@@H]12)OCC |
| InChI | InChI=1S/C13H20NO7P/c1-3-20-22(19,21-4-2)6-7-5-13(14,12(17)18)10-8(7)9(10)11(15)16/h6,8-10H,3-5,14H2,1-2H3,(H,15,16)(H,17,18)/t8-,9-,10+,13-/m1/s1 |
| InChIKey | SBNIXKRIVGOOTB-ORXSELOVSA-N |
| XLogP | 1.27 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|