C15H24FO3P — CID 11120179
(4R,6Z)-6-[diethoxyphosphoryl(fluoro)methylidene]-1-methyl-4-prop-1-en-2-ylcyclohexene (PubChem CID 11120179) has the molecular formula C15H24FO3P and a molecular weight of 302.33 g/mol. Its IUPAC name is (4R,6Z)-6-[diethoxyphosphoryl(fluoro)methylidene]-1-methyl-4-prop-1-en-2-ylcyclohexene.
| Compound Name | (4R,6Z)-6-[diethoxyphosphoryl(fluoro)methylidene]-1-methyl-4-prop-1-en-2-ylcyclohexene |
|---|---|
| PubChem CID | 11120179 |
| Molecular Formula | C15H24FO3P |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (4R,6Z)-6-[diethoxyphosphoryl(fluoro)methylidene]-1-methyl-4-prop-1-en-2-ylcyclohexene |
| SMILES | C=C(C)[C@@H]1CC=C(C)/C(=C(/F)P(=O)(OCC)OCC)C1 |
| InChI | InChI=1S/C15H24FO3P/c1-6-18-20(17,19-7-2)15(16)14-10-13(11(3)4)9-8-12(14)5/h8,13H,3,6-7,9-10H2,1-2,4-5H3/b15-14-/t13-/m1/s1 |
| InChIKey | OBRVNYDWRIQLDC-FARYLTDUSA-N |
| XLogP | 5.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|