C22H29N3O3 — CID 6275499
N-(4-ethoxyphenyl)-N'-[(E)-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino]butanediamide (PubChem CID 6275499) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-N'-[(E)-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino]butanediamide.
| Compound Name | N-(4-ethoxyphenyl)-N'-[(E)-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino]butanediamide |
|---|---|
| PubChem CID | 6275499 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-(4-ethoxyphenyl)-N'-[(E)-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino]butanediamide |
| SMILES | C=C(C)C1CC=C(C)/C(=N/NC(=O)CCC(=O)Nc2ccc(OCC)cc2)C1 |
| InChI | InChI=1S/C22H29N3O3/c1-5-28-19-10-8-18(9-11-19)23-21(26)12-13-22(27)25-24-20-14-17(15(2)3)7-6-16(20)4/h6,8-11,17H,2,5,7,12-14H2,1,3-4H3,(H,23,26)(H,25,27)/b24-20+ |
| InChIKey | AFWBFOFBZQMMBV-HIXSDJFHSA-N |
| XLogP | 4.21 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|