C18H25N3O5 — CID 5118044
ethyl 3-[[4-(4-ethoxyanilino)-4-oxobutanoyl]hydrazinylidene]butanoate (PubChem CID 5118044) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is ethyl 3-[[4-(4-ethoxyanilino)-4-oxobutanoyl]hydrazinylidene]butanoate.
| Compound Name | ethyl 3-[[4-(4-ethoxyanilino)-4-oxobutanoyl]hydrazinylidene]butanoate |
|---|---|
| PubChem CID | 5118044 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | ethyl 3-[[4-(4-ethoxyanilino)-4-oxobutanoyl]hydrazinylidene]butanoate |
| SMILES | CCOC(=O)CC(C)=NNC(=O)CCC(=O)Nc1ccc(OCC)cc1 |
| InChI | InChI=1S/C18H25N3O5/c1-4-25-15-8-6-14(7-9-15)19-16(22)10-11-17(23)21-20-13(3)12-18(24)26-5-2/h6-9H,4-5,10-12H2,1-3H3,(H,19,22)(H,21,23) |
| InChIKey | NWSUTLWJNHSDAK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|