C20H29N3O5 — CID 6275505
ethyl (3Z)-3-[[4-(4-ethoxyanilino)-4-oxobutanoyl]hydrazinylidene]-2-ethylbutanoate (PubChem CID 6275505) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is ethyl (3Z)-3-[[4-(4-ethoxyanilino)-4-oxobutanoyl]hydrazinylidene]-2-ethylbutanoate.
| Compound Name | ethyl (3Z)-3-[[4-(4-ethoxyanilino)-4-oxobutanoyl]hydrazinylidene]-2-ethylbutanoate |
|---|---|
| PubChem CID | 6275505 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | ethyl (3Z)-3-[[4-(4-ethoxyanilino)-4-oxobutanoyl]hydrazinylidene]-2-ethylbutanoate |
| SMILES | CCOC(=O)C(CC)/C(C)=N\NC(=O)CCC(=O)Nc1ccc(OCC)cc1 |
| InChI | InChI=1S/C20H29N3O5/c1-5-17(20(26)28-7-3)14(4)22-23-19(25)13-12-18(24)21-15-8-10-16(11-9-15)27-6-2/h8-11,17H,5-7,12-13H2,1-4H3,(H,21,24)(H,23,25)/b22-14- |
| InChIKey | HHRXRTVCQJQMFY-HMAPJEAMSA-N |
| XLogP | 2.89 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|