C22H29N3O2 — CID 129460878
N-(2,4-dimethylphenyl)-N'-[[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]butanediamide (PubChem CID 129460878) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-N'-[[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]butanediamide.
| Compound Name | N-(2,4-dimethylphenyl)-N'-[[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]butanediamide |
|---|---|
| PubChem CID | 129460878 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | N-(2,4-dimethylphenyl)-N'-[[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]butanediamide |
| SMILES | C=C(C)[C@@H]1CC=C(C)C(=NNC(=O)CCC(=O)Nc2ccc(C)cc2C)C1 |
| InChI | InChI=1S/C22H29N3O2/c1-14(2)18-8-7-16(4)20(13-18)24-25-22(27)11-10-21(26)23-19-9-6-15(3)12-17(19)5/h6-7,9,12,18H,1,8,10-11,13H2,2-5H3,(H,23,26)(H,25,27)/t18-/m1/s1 |
| InChIKey | YEEPOPZYKIVGNK-GOSISDBHSA-N |
| XLogP | 4.43 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|