C20H24N2O — CID 7296101
cis-(1S,2R)-N-[(Z)-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 7296101) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is cis-(1S,2R)-N-[(Z)-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2R)-N-[(Z)-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7296101 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | cis-(1S,2R)-N-[(Z)-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | C=C(C)[C@@H]1CC=C(C)/C(=N\NC(=O)[C@H]2C[C@H]2c2ccccc2)C1 |
| InChI | InChI=1S/C20H24N2O/c1-13(2)16-10-9-14(3)19(11-16)21-22-20(23)18-12-17(18)15-7-5-4-6-8-15/h4-9,16-18H,1,10-12H2,2-3H3,(H,22,23)/b21-19-/t16-,17+,18+/m1/s1 |
| InChIKey | KATNNXZDWUXEDO-WGFPAZGCSA-N |
| XLogP | 4.19 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|