C20H24ClN3O2 — CID 7323557
N-(2-chlorophenyl)-N'-[(E)-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]butanediamide (PubChem CID 7323557) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-[(E)-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]butanediamide.
| Compound Name | N-(2-chlorophenyl)-N'-[(E)-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]butanediamide |
|---|---|
| PubChem CID | 7323557 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-(2-chlorophenyl)-N'-[(E)-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]amino]butanediamide |
| SMILES | C=C(C)[C@@H]1CC=C(C)/C(=N/NC(=O)CCC(=O)Nc2ccccc2Cl)C1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-13(2)15-9-8-14(3)18(12-15)23-24-20(26)11-10-19(25)22-17-7-5-4-6-16(17)21/h4-8,15H,1,9-12H2,2-3H3,(H,22,25)(H,24,26)/b23-18+/t15-/m1/s1 |
| InChIKey | UJKXPMGZUYQULT-SAZKUCFMSA-N |
| XLogP | 4.46 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|