C19H24ClN3O — CID 6168052
2-(3-chloro-2-methylanilino)-N-[(E)-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino]acetamide (PubChem CID 6168052) has the molecular formula C19H24ClN3O and a molecular weight of 345.87 g/mol. Its IUPAC name is 2-(3-chloro-2-methylanilino)-N-[(E)-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino]acetamide.
| Compound Name | 2-(3-chloro-2-methylanilino)-N-[(E)-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 6168052 |
| Molecular Formula | C19H24ClN3O |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-(3-chloro-2-methylanilino)-N-[(E)-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino]acetamide |
| SMILES | C=C(C)C1CC=C(C)/C(=N/NC(=O)CNc2cccc(Cl)c2C)C1 |
| InChI | InChI=1S/C19H24ClN3O/c1-12(2)15-9-8-13(3)18(10-15)22-23-19(24)11-21-17-7-5-6-16(20)14(17)4/h5-8,15,21H,1,9-11H2,2-4H3,(H,23,24)/b22-18+ |
| InChIKey | MFVXKDCYNHLDKW-RELWKKBWSA-N |
| XLogP | 4.46 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|