C17H18FNO2 — CID 3959513
[(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino] 4-fluorobenzoate (PubChem CID 3959513) has the molecular formula C17H18FNO2 and a molecular weight of 287.33 g/mol. Its IUPAC name is [(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino] 4-fluorobenzoate.
| Compound Name | [(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino] 4-fluorobenzoate |
|---|---|
| PubChem CID | 3959513 |
| Molecular Formula | C17H18FNO2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | [(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino] 4-fluorobenzoate |
| SMILES | C=C(C)C1CC=C(C)C(=NOC(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H18FNO2/c1-11(2)14-5-4-12(3)16(10-14)19-21-17(20)13-6-8-15(18)9-7-13/h4,6-9,14H,1,5,10H2,2-3H3 |
| InChIKey | KIQKDQZFNFKPPD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|