C15H17NO2S — CID 134107251
[(E)-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino] thiophene-2-carboxylate (PubChem CID 134107251) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is [(E)-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino] thiophene-2-carboxylate.
| Compound Name | [(E)-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 134107251 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | [(E)-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene)amino] thiophene-2-carboxylate |
| SMILES | C=C(C)C1CC=C(C)/C(=N/OC(=O)c2cccs2)C1 |
| InChI | InChI=1S/C15H17NO2S/c1-10(2)12-7-6-11(3)13(9-12)16-18-15(17)14-5-4-8-19-14/h4-6,8,12H,1,7,9H2,2-3H3/b16-13+ |
| InChIKey | XNPHVHJVZWTWSU-DTQAZKPQSA-N |
| XLogP | 4.19 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|