C19H23NO — CID 62802871
5-(2-ethoxyphenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-amine (PubChem CID 62802871) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 5-(2-ethoxyphenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-amine.
| Compound Name | 5-(2-ethoxyphenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-amine |
|---|---|
| PubChem CID | 62802871 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 5-(2-ethoxyphenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-amine |
| SMILES | CCOc1ccccc1C1(N)CCCCc2ccccc21 |
| InChI | InChI=1S/C19H23NO/c1-2-21-18-13-6-5-12-17(18)19(20)14-8-7-10-15-9-3-4-11-16(15)19/h3-6,9,11-13H,2,7-8,10,14,20H2,1H3 |
| InChIKey | ULADFOOLIQKHBX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |