C18H21NO — CID 62801884
2-(2-ethoxyphenyl)-3,4-dihydro-1H-naphthalen-2-amine (PubChem CID 62801884) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-(2-ethoxyphenyl)-3,4-dihydro-1H-naphthalen-2-amine.
| Compound Name | 2-(2-ethoxyphenyl)-3,4-dihydro-1H-naphthalen-2-amine |
|---|---|
| PubChem CID | 62801884 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-(2-ethoxyphenyl)-3,4-dihydro-1H-naphthalen-2-amine |
| SMILES | CCOc1ccccc1C1(N)CCc2ccccc2C1 |
| InChI | InChI=1S/C18H21NO/c1-2-20-17-10-6-5-9-16(17)18(19)12-11-14-7-3-4-8-15(14)13-18/h3-10H,2,11-13,19H2,1H3 |
| InChIKey | ULNQTNFSPNOGKF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |