C24H26NO2P — CID 135391786
N-benzyl-1-[ethoxy(phenyl)phosphoryl]-2,3-dihydroinden-1-amine (PubChem CID 135391786) has the molecular formula C24H26NO2P and a molecular weight of 391.45 g/mol. Its IUPAC name is N-benzyl-1-[ethoxy(phenyl)phosphoryl]-2,3-dihydroinden-1-amine.
| Compound Name | N-benzyl-1-[ethoxy(phenyl)phosphoryl]-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 135391786 |
| Molecular Formula | C24H26NO2P |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-benzyl-1-[ethoxy(phenyl)phosphoryl]-2,3-dihydroinden-1-amine |
| SMILES | CCOP(=O)(c1ccccc1)C1(NCc2ccccc2)CCc2ccccc21 |
| InChI | InChI=1S/C24H26NO2P/c1-2-27-28(26,22-14-7-4-8-15-22)24(25-19-20-11-5-3-6-12-20)18-17-21-13-9-10-16-23(21)24/h3-16,25H,2,17-19H2,1H3 |
| InChIKey | KHRCKRSFXAJBDR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|