C15H23N — CID 82919598
1-(2-ethylbutyl)-2,3-dihydroinden-1-amine (PubChem CID 82919598) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 1-(2-ethylbutyl)-2,3-dihydroinden-1-amine.
| Compound Name | 1-(2-ethylbutyl)-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 82919598 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 1-(2-ethylbutyl)-2,3-dihydroinden-1-amine |
| SMILES | CCC(CC)CC1(N)CCc2ccccc21 |
| InChI | InChI=1S/C15H23N/c1-3-12(4-2)11-15(16)10-9-13-7-5-6-8-14(13)15/h5-8,12H,3-4,9-11,16H2,1-2H3 |
| InChIKey | ROWJIHBKEFCTJH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |