1-(2-methylbutyl)-2,3-dihydroindene-1-carboxylic acid

C15H20O2 — CID 65408733

IUPAC1-(2-methylbutyl)-2,3-dihydroindene-1-carboxylic acid
SMILESCCC(C)CC1(C(=O)O)CCc2ccccc21
InChIInChI=1S/C15H20O2/c1-3-11(2)10-15(14(16)17)9-8-12-6-4-5-7-13(12)15/h4-7,11H,3,8-10H2,1-2H3,(H,16,17)
InChIKeyNQIKARIIEXSNTP-UHFFFAOYSA-N
MW232.32 g/mol
LogP3.39
Rot. Bonds4

About 1-(2-methylbutyl)-2,3-dihydroindene-1-carboxylic acid

1-(2-methylbutyl)-2,3-dihydroindene-1-carboxylic acid (PubChem CID 65408733) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 1-(2-methylbutyl)-2,3-dihydroindene-1-carboxylic acid.

Molecular Properties

Compound Name1-(2-methylbutyl)-2,3-dihydroindene-1-carboxylic acid
PubChem CID65408733
Molecular FormulaC15H20O2
Molecular Weight232.32 g/mol
Exact Mass232.15
IUPAC Name1-(2-methylbutyl)-2,3-dihydroindene-1-carboxylic acid
SMILESCCC(C)CC1(C(=O)O)CCc2ccccc21
InChIInChI=1S/C15H20O2/c1-3-11(2)10-15(14(16)17)9-8-12-6-4-5-7-13(12)15/h4-7,11H,3,8-10H2,1-2H3,(H,16,17)
InChIKeyNQIKARIIEXSNTP-UHFFFAOYSA-N
XLogP3.39
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.32
LogP ≤ 53.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 1-(2-methylbutyl)-2,3-dihydroindene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2-methylbutyl)-2,3-dihydroindene-1-carboxylic acid?
The IUPAC name of 1-(2-methylbutyl)-2,3-dihydroindene-1-carboxylic acid (CID 65408733) is 1-(2-methylbutyl)-2,3-dihydroindene-1-carboxylic acid.
What is the SMILES notation for 1-(2-methylbutyl)-2,3-dihydroindene-1-carboxylic acid?
The canonical SMILES for 1-(2-methylbutyl)-2,3-dihydroindene-1-carboxylic acid is CCC(C)CC1(C(=O)O)CCc2ccccc21.
What is the InChIKey of 1-(2-methylbutyl)-2,3-dihydroindene-1-carboxylic acid?
The InChIKey is NQIKARIIEXSNTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O2/c1-3-11(2)10-15(14(16)17)9-8-12-6-4-5-7-13(12)15/h4-7,11H,3,8-10H2,1-2H3,(H,16,17).
What are the key properties of 1-(2-methylbutyl)-2,3-dihydroindene-1-carboxylic acid?
1-(2-methylbutyl)-2,3-dihydroindene-1-carboxylic acid has a molecular weight of 232.32 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylbutyl)-2,3-dihydroindene-1-carboxylic acid is sourced from PubChem (CID 65408733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).