C14H14ClNS — CID 112749484
1-[(3-chlorothiophen-2-yl)methyl]-2,3-dihydroinden-1-amine (PubChem CID 112749484) has the molecular formula C14H14ClNS and a molecular weight of 263.79 g/mol. Its IUPAC name is 1-[(3-chlorothiophen-2-yl)methyl]-2,3-dihydroinden-1-amine.
| Compound Name | 1-[(3-chlorothiophen-2-yl)methyl]-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 112749484 |
| Molecular Formula | C14H14ClNS |
| Molecular Weight | 263.79 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 1-[(3-chlorothiophen-2-yl)methyl]-2,3-dihydroinden-1-amine |
| SMILES | NC1(Cc2sccc2Cl)CCc2ccccc21 |
| InChI | InChI=1S/C14H14ClNS/c15-12-6-8-17-13(12)9-14(16)7-5-10-3-1-2-4-11(10)14/h1-4,6,8H,5,7,9,16H2 |
| InChIKey | ACRSJJIENBJYRW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.79 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |