C14H13ClOS — CID 107358956
1-(3-chlorothiophen-2-yl)-3,4-dihydro-2H-naphthalen-1-ol (PubChem CID 107358956) has the molecular formula C14H13ClOS and a molecular weight of 264.78 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-3,4-dihydro-2H-naphthalen-1-ol.
| Compound Name | 1-(3-chlorothiophen-2-yl)-3,4-dihydro-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 107358956 |
| Molecular Formula | C14H13ClOS |
| Molecular Weight | 264.78 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-3,4-dihydro-2H-naphthalen-1-ol |
| SMILES | OC1(c2sccc2Cl)CCCc2ccccc21 |
| InChI | InChI=1S/C14H13ClOS/c15-12-7-9-17-13(12)14(16)8-3-5-10-4-1-2-6-11(10)14/h1-2,4,6-7,9,16H,3,5,8H2 |
| InChIKey | NIWRDKVPBKECJJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.78 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |