C14H28O6P2 — CID 19821537
3,3-bis(diethoxyphosphoryl)cyclohexene (PubChem CID 19821537) has the molecular formula C14H28O6P2 and a molecular weight of 354.32 g/mol. Its IUPAC name is 3,3-bis(diethoxyphosphoryl)cyclohexene.
| Compound Name | 3,3-bis(diethoxyphosphoryl)cyclohexene |
|---|---|
| PubChem CID | 19821537 |
| Molecular Formula | C14H28O6P2 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 3,3-bis(diethoxyphosphoryl)cyclohexene |
| SMILES | CCOP(=O)(OCC)C1(P(=O)(OCC)OCC)C=CCCC1 |
| InChI | InChI=1S/C14H28O6P2/c1-5-17-21(15,18-6-2)14(12-10-9-11-13-14)22(16,19-7-3)20-8-4/h10,12H,5-9,11,13H2,1-4H3 |
| InChIKey | PVNRVCNZUJARPP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|